
CAS 849-99-0
:1,6-Dicyclohexyl hexanedioate
Description:
1,6-Dicyclohexyl hexanedioate, with the CAS number 849-99-0, is an organic compound characterized by its ester functional groups derived from hexanedioic acid (sebacic acid) and cyclohexanol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively high molecular weight and low volatility, which contribute to its stability under various conditions. The presence of cyclohexyl groups imparts hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 1,6-Dicyclohexyl hexanedioate is often utilized in applications such as plasticizers, lubricants, and as an intermediate in organic synthesis. Its thermal stability and resistance to oxidation make it suitable for use in high-performance materials. Additionally, it may exhibit low toxicity, but safety data should always be consulted for handling and exposure guidelines. Overall, this compound is valued for its unique structural properties and versatility in chemical applications.
Formula:C18H30O4
InChI:InChI=1S/C18H30O4/c19-17(21-15-9-3-1-4-10-15)13-7-8-14-18(20)22-16-11-5-2-6-12-16/h15-16H,1-14H2
InChI key:InChIKey=UTGUHFOMNVLJSL-UHFFFAOYSA-N
SMILES:O(C(CCCCC(OC1CCCCC1)=O)=O)C2CCCCC2
Synonyms:- Adipic acid, dicyclohexyl ester
- Hexanedioic acid, dicyclohexyl ester
- Hexanedioic acid, 1,6-dicyclohexyl ester
- Ergoplast ADC
- 1,6-Dicyclohexyl hexanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Adipic acid, dicyclohexyl ester
CAS:Controlled ProductFormula:C18H30O4Color and Shape:NeatMolecular weight:310.43Adipic acid dicyclohexyl ester
CAS:Adipic acid dicyclohexyl ester is a biochemical.Formula:C18H30O4Color and Shape:SolidMolecular weight:310.434


