CAS 849020-92-4
:methyl 2-(aminomethyl)benzoate hydrochloride
Description:
Methyl 2-(aminomethyl)benzoate hydrochloride, with the CAS number 849020-92-4, is a chemical compound that belongs to the class of benzoate esters. It features a benzoic acid derivative with an amino group attached to the benzene ring, which enhances its potential for biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form indicates that it is a stable, ionic compound, which can improve its solubility and bioavailability. Methyl 2-(aminomethyl)benzoate hydrochloride may be utilized in pharmaceutical research, particularly in the development of drugs due to its potential interactions with biological systems. Its structural characteristics allow for various functional modifications, which can lead to the synthesis of derivatives with enhanced properties. As with many chemical substances, proper handling and safety precautions are essential, given its potential biological activity and the need for thorough understanding in laboratory settings.
Formula:C9H12ClNO2
InChI:InChI=1/C9H11NO2.ClH/c1-12-9(11)8-5-3-2-4-7(8)6-10;/h2-5H,6,10H2,1H3;1H
SMILES:COC(=O)c1ccccc1CN.Cl
Synonyms:- Benzoic acid, 2-(aminomethyl)-, methyl ester, hydrochloride (1:1)
- Methyl 2-(aminomethyl)benzoate hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-CARBOMETHOXYBENZYLAMINEHYDROCHLORIDE
CAS:Formula:C9H12ClNO2Purity:95%Color and Shape:SolidMolecular weight:201.65012-Carbomethoxybenzylamine hydrochloride
CAS:Formula:C9H12ClNO2Purity:95.0%Color and Shape:SolidMolecular weight:201.65Methyl 2-(aminomethyl)benzoate hydrochloride
CAS:<p>Methyl 2-(aminomethyl)benzoate hydrochloride</p>Formula:C9H11NO2·ClHPurity:95%Color and Shape: white solidMolecular weight:201.65g/mol2-Carbomethoxybenzylamine hydrochloride
CAS:2-Carbomethoxybenzylamine hydrochloride is a versatile compound with various applications. It exhibits cytotoxic properties, making it useful in cancer research and drug development. Additionally, it has anticoagulant properties, which can be beneficial in the treatment of certain medical conditions.Formula:C9H12ClNO2Purity:Min. 95%Molecular weight:201.65 g/mol



