CAS 849020-92-4

methyl 2-(aminomethyl)benzoate hydrochloride

Description:

Methyl 2-(aminomethyl)benzoate hydrochloride, with the CAS number 849020-92-4, is a chemical compound that belongs to the class of benzoate esters. It features a benzoic acid derivative with an amino group attached to the benzene ring, which enhances its potential for biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form indicates that it is a stable, ionic compound, which can improve its solubility and bioavailability. Methyl 2-(aminomethyl)benzoate hydrochloride may be utilized in pharmaceutical research, particularly in the development of drugs due to its potential interactions with biological systems. Its structural characteristics allow for various functional modifications, which can lead to the synthesis of derivatives with enhanced properties. As with many chemical substances, proper handling and safety precautions are essential, given its potential biological activity and the need for thorough understanding in laboratory settings.

Formula: C₉H₁₂ClNO₂

InChI: InChI=1/C9H11NO2.ClH/c1-12-9(11)8-5-3-2-4-7(8)6-10;/h2-5H,6,10H2,1H3;1H

SMILES: COC(=O)c1ccccc1CN.Cl

Synonyms:

• Benzoic acid, 2-(aminomethyl)-, methyl ester, hydrochloride (1:1)
• Methyl 2-(aminomethyl)benzoate hydrochloride (1:1)

2-CARBOMETHOXYBENZYLAMINEHYDROCHLORIDE

CAS: 849020-92-4

Formula: C₉H₁₂ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.6501

Ref: IN-DA00G4IL

2-Carbomethoxybenzylamine hydrochloride

CAS: 849020-92-4

Formula: C₉H₁₂ClNO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 201.65

Ref: 10-F023463

Methyl 2-(aminomethyl)benzoate hydrochloride

CAS: 849020-92-4

Methyl 2-(aminomethyl)benzoate hydrochloride

Formula: C₉H₁₁NO₂·ClH

Purity: 95%

Color and Shape: white solid

Molecular weight: 201.65g/mol

Ref: 54-OR0170

2-Carbomethoxybenzylamine hydrochloride

CAS: 849020-92-4

2-Carbomethoxybenzylamine hydrochloride is a versatile compound with various applications. It exhibits cytotoxic properties, making it useful in cancer research and drug development. Additionally, it has anticoagulant properties, which can be beneficial in the treatment of certain medical conditions.

Formula: C₉H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 201.65 g/mol

Ref: 3D-ZIB02092