CAS 849035-73-0

[2-Bromo-4-(methylsulfonyl)phenyl]hydrazine

Description:

[2-Bromo-4-(methylsulfonyl)phenyl]hydrazine is an organic compound characterized by its hydrazine functional group, which is attached to a phenyl ring that features both a bromine atom and a methylsulfonyl group. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methylsulfonyl group enhances the compound's solubility in polar solvents and may influence its biological activity. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its structure suggests potential applications in medicinal chemistry, where modifications can lead to derivatives with specific biological properties. Safety considerations are important when handling this compound, as it may pose health risks typical of hydrazine derivatives, including toxicity and potential carcinogenicity. Proper laboratory protocols should be followed to ensure safe handling and disposal.

Formula: C₇H₉BrN₂O₂S

InChI: InChI=1S/C7H9BrN2O2S/c1-13(11,12)5-2-3-7(10-9)6(8)4-5/h2-4,10H,9H2,1H3

InChI key: InChIKey=CCGWLSRTZZBNTG-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC(Br)=C(NN)C=C1

Synonyms:

• [2-Bromo-4-(methylsulfonyl)phenyl]hydrazine
• (2-Bromo-4-methanesulfonylphenyl)hydrazine
• Hydrazine, [2-bromo-4-(methylsulfonyl)phenyl]-

[2-Bromo-4-(methylsulfonyl)phenyl]hydrazine

CAS: 849035-73-0

Formula: C₇H₉BrN₂O₂S

Molecular weight: 265.1276

Ref: IN-DA004VML

2-Bromo-4-(methylsulphonyl)phenylhydrazine

CAS: 849035-73-0

2-Bromo-4-(methylsulphonyl)phenylhydrazine

Formula: C₇H₉BrN₂O₂S

Purity: 95%

Color and Shape: pale brown solid

Molecular weight: 265.13g/mol

Ref: 54-OR7916

[2-Bromo-4-(methylsulfonyl)phenyl]hydrazine

CAS: 849035-73-0

Formula: C₇H₉BrN₂O₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 265.13

Ref: 10-F023635