CAS 849052-23-9

{3-bromo-2-[(4-chlorobenzyl)oxy]phenyl}boronic acid

Description:

{3-bromo-2-[(4-chlorobenzyl)oxy]phenyl}boronic acid, with the CAS number 849052-23-9, is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a bromine atom and a 4-chlorobenzyl ether moiety attached to a phenyl ring, contributing to its unique reactivity and potential applications in medicinal chemistry and materials science. The boronic acid group allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the presence of halogen substituents can influence the compound's electronic properties and solubility, which are critical for its behavior in various chemical environments. Overall, this compound's structural features suggest potential utility in drug development and as a building block in organic synthesis.

Formula: C₁₃H₁₁BBrClO₃

InChI: InChI=1/C13H11BBrClO3/c15-12-3-1-2-11(14(17)18)13(12)19-8-9-4-6-10(16)7-5-9/h1-7,17-18H,8H2

SMILES: c1cc(c(c(c1)Br)OCc1ccc(cc1)Cl)B(O)O

Synonyms:

• 3-Bromo-2-(4'-chlorobenzyloxy)phenylboronic acid
• Boronic acid, B-[3-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-

3-Bromo-2-(4'-chlorobenzyloxy)phenylboronic acid

CAS: 849052-23-9

Formula: C₁₃H₁₁BBrClO₃

Color and Shape: Solid

Molecular weight: 341.3926

Ref: IN-DA003BR6

3-Bromo-2-(4'-chlorobenzyloxy)phenylboronic acid

CAS: 849052-23-9

3-Bromo-2-(4'-chlorobenzyloxy)phenylboronic acid

Purity: ≥95%

Molecular weight: 341.39g/mol

Ref: 54-OR360773