CAS 84906-81-0

2-Hydroxyquinoline-4-carboxylic acid

Description:

2-Hydroxyquinoline-4-carboxylic acid, also known by its CAS number 84906-81-0, is an organic compound that features a quinoline structure with both a hydroxyl group and a carboxylic acid group. This compound typically appears as a solid, often in crystalline form, and is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the hydroxyl group (-OH) and the carboxylic acid group (-COOH) imparts both acidic and polar characteristics, making it soluble in polar solvents like water and alcohols. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Additionally, its ability to form chelates with metal ions enhances its utility in coordination chemistry. Overall, 2-Hydroxyquinoline-4-carboxylic acid is a versatile compound with significant implications in research and industry.

Formula: C₁₀H₇NO₃

InChI: InChI=1/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14)/p-1

SMILES: c1ccc2c(c1)c(cc(n2)[O-])C(=O)O

Synonyms:

• 2-Hydroxycinchoninic acid
• 2-Oxo-1,2-Dihydroquinoline-4-Carboxylate
• 2-Hydroxy-4-Quinolincarboxylic Acid

2-Hydroxyquinoline-4-carboxylic acid

CAS: 84906-81-0

Formula: C₁₀H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.1675

Ref: IN-DA003HG4

2-Hydroxyquinoline-4-Carboxylic Acid

CAS: 84906-81-0

2-Hydroxyquinoline-4-Carboxylic Acid

Purity: 99%

Molecular weight: 189.17g/mol

Ref: 54-OR1030180