CAS 84906-82-1

4-Quinolinecarboxylic acid, 2-hydroxy-, methyl ester

Description:

4-Quinolinecarboxylic acid, 2-hydroxy-, methyl ester, with the CAS number 84906-82-1, is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid group and a methoxy group, contributing to its reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the hydroxyl and carboxyl functional groups. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Its synthesis often involves the esterification of the corresponding carboxylic acid with methanol. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 4-Quinolinecarboxylic acid, 2-hydroxy-, methyl ester is a versatile compound with applications in research and industry.

Formula: C₁₁H₉NO₃

InChI: InChI=1S/C11H9NO3/c1-15-11(14)8-6-10(13)12-9-5-3-2-4-7(8)9/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=VVZNRIXRLYHAKG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(N=C(O)C1)C=CC=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-hydroxy-, methyl ester

2-Hydroxy-4-quinolinecarboxylic Acid Methyl Ester

Controlled Product

CAS: 84906-82-1

Formula: C₁₁H₉NO₃

Color and Shape: Neat

Molecular weight: 203.19

Ref: 86-MM0604.07