CAS 849062-25-5
:B-[4-[(3-Bromophenyl)methoxy]-3-chlorophenyl]boronic acid
Description:
B-[4-[(3-Bromophenyl)methoxy]-3-chlorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a complex aromatic structure, incorporating both bromine and chlorine substituents, which can influence its reactivity and solubility. The methoxy group enhances its electronic properties, potentially affecting its interactions in biological systems. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of halogen atoms may impart unique properties, such as increased lipophilicity or altered biological activity. Overall, this compound's structural characteristics suggest potential utility in drug development and materials science, particularly in the synthesis of complex organic molecules.
Formula:C13H11BBrClO3
InChI:InChI=1S/C13H11BBrClO3/c15-11-3-1-2-9(6-11)8-19-13-5-4-10(14(17)18)7-12(13)16/h1-7,17-18H,8H2
InChI key:InChIKey=HKBRUUCYKMOURT-UHFFFAOYSA-N
SMILES:O(CC1=CC(Br)=CC=C1)C2=C(Cl)C=C(B(O)O)C=C2
Synonyms:- B-[4-[(3-Bromophenyl)methoxy]-3-chlorophenyl]boronic acid
- Boronic acid, [4-[(3-bromophenyl)methoxy]-3-chlorophenyl]-
- 3-Chloro-4-(3′-bromobenzyloxy)phenylboronic acid
- Boronic acid, B-[4-[(3-bromophenyl)methoxy]-3-chlorophenyl]-
- [4-[(3-Bromobenzyl)oxy]-3-chlorophenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
