CymitQuimica logo

CAS 849062-27-7

:

{3-bromo-2-[(3-bromobenzyl)oxy]phenyl}boronic acid

Description:
{3-bromo-2-[(3-bromobenzyl)oxy]phenyl}boronic acid, with the CAS number 849062-27-7, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl ring that is substituted with bromine and a benzyl ether group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of bromine substituents can enhance its reactivity and influence its electronic properties, potentially making it a candidate for cross-coupling reactions in the formation of carbon-carbon bonds. Additionally, boronic acids are known for their role in drug development, particularly in the design of inhibitors for proteasomes and other biological targets. The solubility and stability of this compound can vary depending on the solvent and conditions, which is crucial for its application in laboratory settings. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C13H11BBr2O3
InChI:InChI=1/C13H11BBr2O3/c15-10-4-1-3-9(7-10)8-19-13-11(14(17)18)5-2-6-12(13)16/h1-7,17-18H,8H2
SMILES:c1cc(cc(c1)Br)COc1c(cccc1Br)B(O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.