CAS 849062-32-4

{2-[(3-chlorobenzyl)oxy]phenyl}boronic acid

Description:

{2-[(3-chlorobenzyl)oxy]phenyl}boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a 3-chlorobenzyl ether, enhancing its reactivity and solubility in organic solvents. The boronic acid moiety contributes to its potential as a ligand in palladium-catalyzed cross-coupling reactions, a key process in the formation of carbon-carbon bonds. Additionally, the presence of the chlorine atom can influence the electronic properties of the molecule, potentially affecting its biological activity and interaction with other chemical species. Overall, this compound is of interest in the development of pharmaceuticals and materials science due to its unique structural features and reactivity profile.

Formula: C₁₃H₁₂BClO₃

InChI: InChI=1/C13H12BClO3/c15-11-5-3-4-10(8-11)9-18-13-7-2-1-6-12(13)14(16)17/h1-8,16-17H,9H2

SMILES: c1ccc(c(c1)B(O)O)OCc1cccc(c1)Cl

(2-((3-Chlorobenzyl)oxy)phenyl)boronic acid

CAS: 849062-32-4

Formula: C₁₃H₁₂BClO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 262.4966

Ref: IN-DA004PUP

2-(3'-Chlorobenzyloxy)phenylboronic acid

CAS: 849062-32-4

2-(3'-Chlorobenzyloxy)phenylboronic acid

Purity: 98%

Molecular weight: 262.50g/mol

Ref: 54-OR360904

(2-((3-Chlorobenzyl)oxy)phenyl)boronic acid

CAS: 849062-32-4

Purity: 95%

Molecular weight: 262.5

Ref: 10-F693992