
CAS 849062-35-7
:B-(2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid
Description:
B-(2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a highly fluorinated aromatic ring. The compound features a bromine substituent at the ortho position relative to the boronic acid group, which can influence its reactivity and solubility. The tetrafluorinated phenyl group enhances the compound's electron-withdrawing properties, making it useful in various applications, including organic synthesis and medicinal chemistry. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is significant in the development of sensors and drug delivery systems. Additionally, the presence of multiple fluorine atoms can impart unique physical and chemical properties, such as increased lipophilicity and stability. This compound may also serve as a building block in the synthesis of more complex molecules, particularly in the context of cross-coupling reactions like Suzuki-Miyaura coupling. Overall, B-(2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid is a versatile reagent in modern organic chemistry.
Formula:C6H2BBrF4O2
InChI:InChI=1S/C6H2BBrF4O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H
InChI key:InChIKey=SNFARXZQGCXAEZ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Br)C(F)=C(F)C(F)=C1F
Synonyms:- B-(2-Bromo-3,4,5,6-tetrafluorophenyl)boronic acid
- Boronic acid, (2-bromo-3,4,5,6-tetrafluorophenyl)-
- Boronic acid, B-(2-bromo-3,4,5,6-tetrafluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
