CAS 849067-90-9

1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde

Description:

1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an aldehyde functional group at the 5-position of the pyrrolo[2,3-b]pyridine structure, making it reactive and suitable for various synthetic applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the aldehyde group. The compound is of interest in medicinal chemistry and material science, often serving as an intermediate in the synthesis of biologically active molecules or as a building block for more complex structures. Its reactivity can be attributed to the electron-withdrawing nature of the aldehyde, which can participate in nucleophilic addition reactions. Additionally, the fused ring system may impart specific electronic and steric properties that influence its behavior in chemical reactions and interactions with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c11-5-6-3-7-1-2-9-8(7)10-4-6/h1-5H,(H,9,10)

SMILES: c1c[nH]c2c1cc(cn2)C=O

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridin-5-carbaldehyd
• 1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
• 7-Azaindole-5-carboxaldehyde

1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde

CAS: 849067-90-9

Formula: C₈H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA0032S2

1H-Pyrrolo[2,3-b]pyridine-5-carbaldehyde

CAS: 849067-90-9

1H-Pyrrolo[2,3-b]pyridine-5-carbaldehyde

Purity: 98%

Molecular weight: 146.14604g/mol

Ref: 54-OR308040

1H-Pyrrolo[2,3-b]pyridine-5-carbaldehyde

CAS: 849067-90-9

Formula: C₈H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F237011