CAS 849067-96-5

methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate

Description:

Methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. This compound typically exhibits a molecular structure that includes a carboxylate functional group, enhancing its reactivity and potential for forming various derivatives. It is often used in medicinal chemistry and drug development due to its biological activity, which may include antimicrobial or anticancer properties. The presence of the methyl ester group can influence its solubility and stability, making it suitable for various applications in organic synthesis. Additionally, the compound's molecular weight and specific functional groups can affect its interactions with biological targets, making it a subject of interest in pharmacological studies. Overall, methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate is a versatile compound with significant implications in chemical research and potential therapeutic applications.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-13-9(12)7-4-6-2-3-10-8(6)11-5-7/h2-5H,1H3,(H,10,11)

SMILES: COC(=O)c1cc2ccnc2[nH]c1

Synonyms:

• H-Pyrrolo[2,3-b]pyridine-5-carboxylicacidmethylester
• 1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid, methyl ester
• Methyl-1H-pyrrolo[2,3-b]pyridin-5-carboxylat

Methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate

CAS: 849067-96-5

Formula: C₉H₈N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA0039Q7

Methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate

CAS: 849067-96-5

Methyl 1H-pyrrolo[2,3-b]pyridine-5-carboxylate

Purity: 95%

Molecular weight: 176.17g/mol

Ref: 54-OR301280

1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl ester

CAS: 849067-96-5

Formula: C₉H₈N₂O₂

Purity: 96%

Color and Shape: Yellow powder

Molecular weight: 176.175

Ref: 10-F079033

7-Azaindole-5-carboxylic acid methyl ester

CAS: 849067-96-5

7-Azaindole-5-carboxylic acid methyl ester is an ester derivative that can be synthesized from the reaction of acetyl chloride and diazotization. 7-Azaindole-5-carboxylic acid methyl ester has been used in research for its biological activity, specifically as a cytotoxic agent. It has also been shown to inhibit the growth of cancer cells by alkylation reactions and cyclization reactions. 7-Azaindole-5-carboxylic acid methyl ester has been shown to have antitumor properties with a mechanism that is not yet fully understood.

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Molecular weight: 176.17 g/mol

Ref: 3D-FA16339