CAS 849069-32-5

Ethyl 1H-pyrazolo[3,4-b]pyridine-3-carboxylate

Description:

Ethyl 1H-pyrazolo[3,4-b]pyridine-3-carboxylate is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which features a fused pyrazole and pyridine ring system. This compound typically exhibits a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its ester functional group due to the ethyl carboxylate moiety. It is often recognized for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrazole ring contributes to its reactivity and interaction with various biological targets. Ethyl 1H-pyrazolo[3,4-b]pyridine-3-carboxylate may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. Its synthesis usually involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many heterocycles, it may also display interesting electronic properties due to the conjugated system within its structure.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-2-14-9(13)7-6-4-3-5-10-8(6)12-11-7/h3-5H,2H2,1H3,(H,10,11,12)

InChI key: InChIKey=UWPBZBGGTNNWDP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=2C(NN1)=NC=CC2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, ethyl ester
• Ethyl 1H-pyrazolo[3,4-b]pyridine-3-carboxylate

Ethyl 1H-Pyrazolo[3,4-B]Pyridine-3-Carboxylate

CAS: 849069-32-5

Formula: C₉H₉N₃O₂

Molecular weight: 191.1867

Ref: IN-DA00G70H