CymitQuimica logo

CAS 849091-89-0

:

2-pyrrolidin-1-ylthiazol-4-amine

Description:
2-Pyrrolidin-1-ylthiazol-4-amine, with the CAS number 849091-89-0, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic amines and thiazoles, which may contribute to its potential biological activity. It is often studied in the context of medicinal chemistry due to its possible applications in drug development, particularly in targeting specific biological pathways. The presence of the pyrrolidine ring may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the thiazole component can participate in various chemical reactions, making it a versatile building block in organic synthesis. The compound's solubility, stability, and reactivity can vary based on its environment and the presence of functional groups. Overall, 2-pyrrolidin-1-ylthiazol-4-amine represents a significant interest in research fields focused on pharmacology and organic synthesis.
Formula:C7H11N3S
InChI:InChI=1/C7H11N3S/c8-6-5-11-7(9-6)10-3-1-2-4-10/h5H,1-4,8H2
SMILES:C1CCN(C1)c1nc(cs1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.