CymitQuimica logo

CAS 849100-03-4

:

2-(4-methylpyridin-2-yl)-6-phenyl-1,3,6,2-dioxazaborocane

Description:
2-(4-Methylpyridin-2-yl)-6-phenyl-1,3,6,2-dioxazaborocane is a chemical compound characterized by its unique structure that incorporates a dioxazaborocane ring, which includes boron, oxygen, and nitrogen atoms. This compound features a pyridine ring substituted with a methyl group at the 4-position and a phenyl group at the 6-position of the dioxazaborocane framework. The presence of the boron atom contributes to its potential applications in materials science and organic synthesis, particularly in the development of boron-containing compounds that can serve as catalysts or ligands. The dioxazaborocane structure may also impart interesting electronic and steric properties, making it a subject of interest in medicinal chemistry and drug design. Additionally, the compound's solubility, stability, and reactivity can vary based on its molecular interactions, which are influenced by the functional groups present. Overall, this compound exemplifies the diverse chemistry associated with boron-containing heterocycles.
Formula:C16H19BN2O2
InChI:InChI=1/C16H19BN2O2/c1-14-7-8-18-16(13-14)17-20-11-9-19(10-12-21-17)15-5-3-2-4-6-15/h2-8,13H,9-12H2,1H3
SMILES:Cc1ccnc(c1)B1OCCN(CCO1)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.