CAS 84911-02-4

3-Ethyl-4-methoxybenzenesulfonamide

Description:

3-Ethyl-4-methoxybenzenesulfonamide, with the CAS number 84911-02-4, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzene ring substituted with an ethyl group at the 3-position and a methoxy group at the 4-position, contributing to its unique chemical behavior and potential biological activity. The presence of the sulfonamide group enhances its solubility in polar solvents, making it useful in various chemical applications. Typically, sulfonamides exhibit moderate to high stability under standard conditions, although they can be sensitive to strong acids and bases. The compound may also participate in hydrogen bonding due to the presence of the sulfonamide nitrogen, influencing its interaction with biological targets. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial agents. However, specific reactivity and biological activity would depend on further empirical studies and context of use.

Formula: C₉H₁₃NO₃S

InChI: InChI=1S/C9H13NO3S/c1-3-7-6-8(14(10,11)12)4-5-9(7)13-2/h4-6H,3H2,1-2H3,(H2,10,11,12)

InChI key: InChIKey=OAEHFSYFUFKVEM-UHFFFAOYSA-N

SMILES: C(C)C1=C(OC)C=CC(S(N)(=O)=O)=C1

Synonyms:

• 3-Ethyl-4-methoxybenzene-1-sulfonamide
• Benzenesulfonamide, 3-ethyl-4-methoxy-
• 3-Ethyl-4-methoxybenzenesulfonamide