CAS 84918-96-7
:(2R)-2-chloro-3-methyl-butanoic acid
Description:
(2R)-2-chloro-3-methyl-butanoic acid is an organic compound characterized by its chiral center, which contributes to its specific stereochemistry. As a derivative of butanoic acid, it features a carboxylic acid functional group (-COOH) that imparts acidic properties, allowing it to donate protons in solution. The presence of a chlorine atom at the second carbon position and a methyl group at the third carbon position distinguishes it from other butanoic acid derivatives, influencing its reactivity and interaction with biological systems. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents due to the carboxylic acid group, while the hydrophobic alkyl chain affects its solubility in non-polar solvents. (2R)-2-chloro-3-methyl-butanoic acid may have applications in organic synthesis and pharmaceutical development, particularly in the creation of chiral intermediates. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chlorine content and acidic nature.
Formula:C5H9ClO2
InChI:InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m1/s1
Synonyms:- butanoic acid, 2-chloro-3-methyl-, (2R)-
- (2R)-2-Chloro-3-methylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

