CAS 849226-46-6

2-Ethyl-6-methyl-4-pyridinecarboxylic acid

Description:

2-Ethyl-6-methyl-4-pyridinecarboxylic acid, with the CAS number 849226-46-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) attached to the pyridine ring, specifically at the 4-position, along with ethyl and methyl substituents at the 2 and 6 positions, respectively. These substituents influence its physical and chemical properties, such as solubility and reactivity. Typically, pyridinecarboxylic acids exhibit moderate acidity due to the presence of the carboxylic group, and they can participate in various chemical reactions, including esterification and amidation. The presence of the nitrogen atom in the pyridine ring can also affect the compound's basicity and potential interactions with other molecules. This compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and development.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-3-8-5-7(9(11)12)4-6(2)10-8/h4-5H,3H2,1-2H3,(H,11,12)

InChI key: InChIKey=PFWSVUBVEHQQOK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(CC)N=C(C)C1

Synonyms:

• 2-Ethyl-6-methyl-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-ethyl-6-methyl-
• 2-Ethyl-6-methylisonicotinic acid