CAS 84923-70-6

5-formyl-2-methoxybenzoic acid

Description:

5-Formyl-2-methoxybenzoic acid, with the CAS number 84923-70-6, is an organic compound that features a benzoic acid structure substituted with a formyl group and a methoxy group. This compound typically appears as a solid and is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the formyl group (-CHO) indicates that it can participate in various chemical reactions, such as condensation and oxidation, making it a versatile intermediate in organic synthesis. The methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity and interaction with other molecules. Additionally, the carboxylic acid functional group (-COOH) provides acidic properties, allowing for potential proton donation in chemical reactions. Overall, 5-formyl-2-methoxybenzoic acid is significant in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its functional groups that enable diverse chemical transformations.

Formula: C₉H₈O₄

InChI: InChI=1/C9H8O4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-5H,1H3,(H,11,12)

SMILES: COc1ccc(cc1C(=O)O)C=O

Synonyms:

• Benzoic acid, 5-formyl-2-methoxy-
• 5-Formyl-2-methoxybenzoic acid

5-Formyl-2-methoxybenzoic acid

CAS: 84923-70-6

Formula: C₉H₈O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 180.1574

Ref: IN-DA003MRY

5-Formyl-2-methoxybenzoic acid

CAS: 84923-70-6

5-Formyl-2-methoxybenzoic acid

Purity: 98%

Molecular weight: 180.16g/mol

Ref: 54-OR951686

5-Formyl-2-methoxybenzoic acid

CAS: 84923-70-6

Formula: C₉H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.159

Ref: 10-F237645