
CAS 84930-12-1
:2-[(3,3,5-Trimethylcyclohexyl)oxy]acetaldehyde
Description:
2-[(3,3,5-Trimethylcyclohexyl)oxy]acetaldehyde, with the CAS number 84930-12-1, is an organic compound characterized by its functional groups and structural features. It contains an acetaldehyde moiety, which is a simple aldehyde known for its reactivity and presence in various chemical reactions. The compound features a 3,3,5-trimethylcyclohexyl group, contributing to its hydrophobic characteristics and potentially influencing its physical properties, such as boiling point and solubility. The presence of the ether linkage (the -O- group) indicates that it may exhibit unique reactivity patterns compared to other aldehydes. This compound is likely to be a colorless to pale yellow liquid, with a characteristic odor typical of aldehydes. Its applications may span various fields, including fragrance formulation, organic synthesis, and possibly as an intermediate in the production of more complex chemical entities. Safety data should be consulted for handling and storage, as aldehydes can be irritants and may pose health risks upon exposure.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-9-6-10(13-5-4-12)8-11(2,3)7-9/h4,9-10H,5-8H2,1-3H3
InChI key:InChIKey=ZLVIQMAJLGHJFG-UHFFFAOYSA-N
SMILES:O(CC=O)C1CC(C)(C)CC(C)C1
Synonyms:- Acetaldehyde, 2-[(3,3,5-trimethylcyclohexyl)oxy]-
- 2-[(3,3,5-Trimethylcyclohexyl)oxy]acetaldehyde
- Acetaldehyde, [(3,3,5-trimethylcyclohexyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.