CymitQuimica logo

CAS 849353-34-0

:

4-Bromopyrimidin-5-amine

Description:
4-Bromopyrimidin-5-amine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The compound features a bromine atom substituted at the 4-position and an amino group (-NH2) at the 5-position of the pyrimidine ring. This structure imparts specific chemical properties, including potential reactivity due to the presence of the amino group, which can act as a nucleophile in various chemical reactions. The bromine substituent can also participate in electrophilic aromatic substitution reactions. 4-Bromopyrimidin-5-amine is often utilized in medicinal chemistry and pharmaceutical research as a building block for the synthesis of various bioactive compounds. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, this compound serves as a valuable intermediate in the development of new therapeutic agents.
Formula:C4H4BrN3
InChI:InChI=1/C4H4BrN3/c5-4-3(6)1-7-2-8-4/h1-2H,6H2
InChI key:NXYSMLJPDPVHOE-UHFFFAOYSA-N
SMILES:c1c(c(Br)ncn1)N
Synonyms:
  • 5-Pyrimidinamine, 4-Bromo-
  • 5-Amino-4-bromopyrimidine
  • 4-bromopyrimidin-5-amine
Found 4 products.