CAS 849353-46-4
:4-Amino-3-fluoro-5-iodobenzonitrile
Description:
4-Amino-3-fluoro-5-iodobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a fluorine atom, an iodine atom, and a nitrile group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The nitrile group (-C≡N) contributes to its reactivity, allowing it to undergo various chemical transformations. The fluorine and iodine substituents introduce significant electronegativity differences, which can influence the compound's reactivity and interaction with other molecules. This compound may exhibit interesting properties such as fluorescence or changes in electronic characteristics due to the halogen substitutions. Its unique combination of functional groups makes it a candidate for applications in pharmaceuticals, agrochemicals, or materials science. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C7H4FIN2
InChI:InChI=1/C7H4FIN2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2H,11H2
InChI key:InChIKey=IVUPHTIFWULRNT-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(F)=C(N)C(I)=C1
Synonyms:- 4-Amino-3-fluoro-5-iodobenzonitrile
- Benzonitrile, 4-amino-3-fluoro-5-iodo-
- 4-Amino-3-fluoro-5-iodobenzenecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
