CAS 849354-21-8
:bromo-[3-(1,3-dioxan-2-yl)phenyl]magnesium
Description:
Bromo-[3-(1,3-dioxan-2-yl)phenyl]magnesium, with the CAS number 849354-21-8, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. The presence of the bromo substituent indicates that it can participate in nucleophilic substitution reactions, while the 1,3-dioxane moiety contributes to its solubility and stability in certain solvents. Grignard reagents are typically used to form carbon-carbon bonds, making them valuable intermediates in the synthesis of alcohols, ketones, and other complex organic molecules. The reactivity of this compound can be influenced by factors such as steric hindrance and electronic effects from the surrounding groups. Safety precautions are essential when handling this compound, as Grignard reagents can react violently with water and moisture, releasing flammable hydrocarbons. Overall, bromo-[3-(1,3-dioxan-2-yl)phenyl]magnesium is a versatile reagent in synthetic organic chemistry.
Formula:C10H11BrMgO2
InChI:InChI=1/C10H11O2.BrH.Mg/c1-2-5-9(6-3-1)10-11-7-4-8-12-10;;/h1-2,5-6,10H,4,7-8H2;1H;/q;;+1/p-1/rC10H11BrMgO2/c11-12-9-4-1-3-8(7-9)10-13-5-2-6-14-10/h1,3-4,7,10H,2,5-6H2
SMILES:c1ccc(cc1)C1OCCCO1.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.