
CAS 849357-64-8
:α-(4-Methoxyphenyl)-2-oxiraneethanol
Description:
α-(4-Methoxyphenyl)-2-oxiraneethanol, identified by its CAS number 849357-64-8, is an organic compound characterized by the presence of an epoxide group and a hydroxyl group. The structure features a methoxy-substituted phenyl ring, which contributes to its aromatic properties and potential reactivity. The epoxide group indicates that the compound can participate in various chemical reactions, such as ring-opening reactions, making it a valuable intermediate in organic synthesis. The hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, which could be explored in medicinal chemistry. Additionally, the presence of both the epoxide and hydroxyl functionalities suggests potential applications in polymer chemistry and materials science. Overall, α-(4-Methoxyphenyl)-2-oxiraneethanol is a versatile compound with significant implications in various fields of chemistry.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-13-9-4-2-8(3-5-9)11(12)6-10-7-14-10/h2-5,10-12H,6-7H2,1H3
InChI key:InChIKey=SWJHOHUNHZECFO-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=C(OC)C=C1)C2CO2
Synonyms:- 1-(4-Methoxyphenyl)-2-oxiranylethanol
- Oxiraneethanol, α-(4-methoxyphenyl)-
- 2-Oxiraneethanol, α-(4-methoxyphenyl)-
- α-(4-Methoxyphenyl)-2-oxiraneethanol
- 1-(4-Methoxyphenyl)-2-(oxiran-2-yl)ethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.