CAS 84940-48-7

4-(Difluoromethyl)-2,3,5-trifluoropyridine

Description:

4-(Difluoromethyl)-2,3,5-trifluoropyridine is a fluorinated heterocyclic compound characterized by its pyridine ring substituted with multiple fluorine atoms and a difluoromethyl group. The presence of three fluorine atoms at the 2, 3, and 5 positions of the pyridine ring significantly influences its chemical properties, including increased electronegativity and lipophilicity. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits high thermal stability and is resistant to oxidation, making it suitable for various applications in pharmaceuticals and agrochemicals. The difluoromethyl group enhances its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, due to its unique structure, it may exhibit interesting biological activities, which can be explored in medicinal chemistry. Safety data should be consulted, as fluorinated compounds can pose specific health and environmental risks. Overall, 4-(Difluoromethyl)-2,3,5-trifluoropyridine is a valuable compound in synthetic chemistry and material science.

Formula: C₆H₂F₅N

InChI: InChI=1S/C6H2F5N/c7-2-1-12-6(11)4(8)3(2)5(9)10/h1,5H

InChI key: InChIKey=KULUSXBJVFQCDY-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C(F)=C(F)N=CC1F

Synonyms:

• Pyridine, 4-(difluoromethyl)-2,3,5-trifluoro-
• 4-(Difluoromethyl)-2,3,5-trifluoropyridine
• 2,3,5-Trifluoro-4-(difluoromethyl)pyridine