CymitQuimica logo

CAS 84940-49-8

:

4-(Difluoromethyl)-2,3,6-trifluoropyridine

Description:
4-(Difluoromethyl)-2,3,6-trifluoropyridine is a fluorinated heterocyclic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a difluoromethyl group (-CF2H) at the 4-position and trifluoromethyl groups (-CF3) at the 2, 3, and 6 positions of the pyridine ring. The presence of multiple fluorine atoms significantly influences its chemical properties, including increased lipophilicity and stability, making it useful in various applications such as pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its form, and exhibits a high boiling point due to the strong C-F bonds. Its reactivity is often governed by the electron-withdrawing nature of the fluorine substituents, which can affect nucleophilic attack and other chemical interactions. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C6H2F5N
InChI:InChI=1S/C6H2F5N/c7-3-1-2(5(9)10)4(8)6(11)12-3/h1,5H
InChI key:InChIKey=GLOPHCULLXILBW-UHFFFAOYSA-N
SMILES:C(F)(F)C=1C(F)=C(F)N=C(F)C1
Synonyms:
  • 4-(Difluoromethyl)-2,3,6-trifluoropyridine
  • Pyridine, 4-(difluoromethyl)-2,3,6-trifluoro-
  • 2,3,6-Trifluoro-4-(difluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.