CymitQuimica logo

CAS 84940-50-1

:

Pyridine, 2,3-difluoro-4-(fluoromethyl)-

Description:
Pyridine, 2,3-difluoro-4-(fluoromethyl)-, with the CAS number 84940-50-1, is a fluorinated derivative of pyridine, a heterocyclic aromatic compound. This substance features a pyridine ring substituted with two fluorine atoms at the 2 and 3 positions and a fluoromethyl group at the 4 position. The presence of fluorine atoms enhances the compound's chemical stability and can influence its reactivity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. Pyridine derivatives are known for their ability to act as ligands in coordination chemistry and can participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions. The fluoromethyl group can also impart unique properties, such as increased lipophilicity and altered electronic characteristics. Overall, this compound's specific structure contributes to its potential utility in synthetic organic chemistry and materials science, although detailed safety and handling information should be consulted due to the presence of fluorine, which can pose health and environmental risks.
Formula:C6H4F3N
InChI:InChI=1S/C6H4F3N/c7-3-4-1-2-10-6(9)5(4)8/h1-2H,3H2
InChI key:InChIKey=FPQOHVXCQUNLGP-UHFFFAOYSA-N
SMILES:C(F)C=1C(F)=C(F)N=CC1
Synonyms:
  • 2,3-Difluoro-4-(fluoromethyl)pyridine
  • Pyridine, 2,3-difluoro-4-(fluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.