CymitQuimica logo

CAS 84941-16-2

:

1-(Difluoromethyl)-2-methyl-1H-benzimidazole

Description:
1-(Difluoromethyl)-2-methyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a difluoromethyl group and a methyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmaceutical applications. The difluoromethyl group can influence the compound's lipophilicity and reactivity, potentially enhancing its interaction with biological targets. Additionally, the presence of fluorine atoms often contributes to increased metabolic stability and altered pharmacokinetics. The compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, 1-(Difluoromethyl)-2-methyl-1H-benzimidazole represents a class of compounds with significant potential in drug discovery and development.
Formula:C9H8F2N2
InChI:InChI=1S/C9H8F2N2/c1-6-12-7-4-2-3-5-8(7)13(6)9(10)11/h2-5,9H,1H3
InChI key:InChIKey=AJRUWLNEYCWDTC-UHFFFAOYSA-N
SMILES:C(F)(F)N1C=2C(N=C1C)=CC=CC2
Synonyms:
  • 1-(Difluoromethyl)-2-methyl-1H-1,3-benzodiazole
  • 1-(Difluoromethyl)-2-methyl-1H-benzo[d]imidazole
  • 1-(Difluoromethyl)-2-methylbenzimidazole
  • 1H-benzimidazole, 1-(difluoromethyl)-2-methyl-
  • T56 Bn Dnj Byff C1
  • 1-(Difluoromethyl)-2-methyl-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.