CAS 84946-16-7

4-Amino-5-chloro-2-methoxy-N-(3-methoxy-4-piperidinyl)benzamide

Description:

4-Amino-5-chloro-2-methoxy-N-(3-methoxy-4-piperidinyl)benzamide, with the CAS number 84946-16-7, is a chemical compound characterized by its complex structure, which includes an aromatic benzamide core substituted with an amino group, a chloro atom, and methoxy groups. This compound features a piperidine moiety, which contributes to its potential biological activity. The presence of the amino and chloro groups suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmacophore in drug development. Its methoxy substituents can influence solubility and lipophilicity, affecting its pharmacokinetic properties. The compound's structure indicates potential interactions with biological targets, making it of interest in the fields of pharmaceuticals and biochemistry. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₄H₂₀ClN₃O₃

InChI: InChI=1S/C14H20ClN3O3/c1-20-12-6-10(16)9(15)5-8(12)14(19)18-11-3-4-17-7-13(11)21-2/h5-6,11,13,17H,3-4,7,16H2,1-2H3,(H,18,19)

InChI key: InChIKey=OMLDMGPCWMBPAN-UHFFFAOYSA-N

SMILES: C(NC1C(OC)CNCC1)(=O)C2=C(OC)C=C(N)C(Cl)=C2

Synonyms:

• 4-Amino-5-chloro-2-methoxy-N-(3-methoxy-4-piperidinyl)benzamide
• Benzamide, 4-amino-5-chloro-2-methoxy-N-(3-methoxy-4-piperidinyl)-

(Rac)-Norcisapride

CAS: 84946-16-7

(Rac)-Norcisapride

Purity: ≥98%

Molecular weight: 313.78g/mol

Ref: 54-BUP03973

(Rac)-Norcisapride

CAS: 84946-16-7

Norcisapride, a 5-HT3 and 5-HT4 agonist, treats GI, orofacial, and ENT disorders.

Formula: C₁₄H₂₀ClN₃O₃

Purity: 99.32%

Color and Shape: Soild

Molecular weight: 313.78

Ref: TM-T68116L