
CAS 84946-18-9
:3-(2-Hydroxyethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
3-(2-Hydroxyethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one, with the CAS number 84946-18-9, is a heterocyclic organic compound characterized by its pyrido-pyrimidine structure. This compound features a hydroxyl group and an ethyl side chain, contributing to its solubility and reactivity. It typically exhibits moderate polarity due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The methyl groups at positions 2 and 7 enhance its lipophilicity, potentially influencing its biological activity and interaction with cellular membranes. This compound may possess pharmacological properties, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, the presence of nitrogen atoms in the heterocyclic ring may impart unique electronic properties, affecting its behavior in chemical reactions. Overall, this compound's structural features suggest potential applications in drug development and other fields of chemistry.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-8-3-4-11-13-9(2)10(5-6-15)12(16)14(11)7-8/h3-4,7,15H,5-6H2,1-2H3
InChI key:InChIKey=LKDLUQYXKRFMNW-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(C)=C1CCO)C=CC(C)=C2
Synonyms:- 3-(2-Hydroxyethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-hydroxyethyl)-2,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.