CAS 849461-90-1

2,2,6,6-tetramethylpiperidin-4-yl heptanoate hydrochloride

Description:

2,2,6,6-Tetramethylpiperidin-4-yl heptanoate hydrochloride is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with four methyl groups and an ester functional group derived from heptanoic acid. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is often used in organic synthesis and as a reagent in various chemical reactions due to its stability and reactivity. The presence of the hydrochloride salt form enhances its solubility in water, making it more accessible for various applications. Additionally, the compound may exhibit properties such as being a potential antioxidant or stabilizer in certain formulations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,2,6,6-tetramethylpiperidin-4-yl heptanoate hydrochloride is a versatile compound with applications in both research and industrial settings.

Formula: C₁₆H₃₂ClNO₂

InChI: InChI=1/C16H31NO2.ClH/c1-6-7-8-9-10-14(18)19-13-11-15(2,3)17-16(4,5)12-13;/h13,17H,6-12H2,1-5H3;1H

SMILES: CCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1.Cl

nAChR-IN-1

CAS: 849461-90-1

Formula: C₁₆H₃₁NO₂

Purity: 98%

Molecular weight: 269.4228

Ref: IN-DA00G62G

TMPH

CAS: 849461-90-1

TMPH

Purity: ≥98%

Molecular weight: 269.42g/mol

Ref: 54-BUP13106

TMPH

CAS: 849461-90-1

TMPH is an inhibitor of nAChR and inhibits nAChRs lacking α5, α6, or β3 subunits. TMPH can be used in studies about nAChR dysfunction or neurological disorders.

Formula: C₁₆H₃₁NO₂

Purity: 99.78%

Color and Shape: Soild

Molecular weight: 269.42

Ref: TM-T60080