CAS 849461-91-2
:2,2,6,6-tetramethylpiperidin-4-yl heptanoate hydrochloride
Description:
2,2,6,6-Tetramethylpiperidin-4-yl heptanoate hydrochloride is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with four methyl groups and an ester functional group derived from heptanoic acid. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. It is often used in organic synthesis and may serve as a stabilizer or additive in various applications, including polymer chemistry and pharmaceuticals. The presence of the hydrochloride salt form enhances its solubility in water, making it more accessible for various chemical reactions. Additionally, the compound may exhibit specific biological activities, which can be of interest in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C16H32ClNO2
InChI:InChI=1/C16H31NO2.ClH/c1-6-7-8-9-10-14(18)19-13-11-15(2,3)17-16(4,5)12-13;/h13,17H,6-12H2,1-5H3;1H
SMILES:CCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
TMPH Hydrochloride
CAS:Controlled ProductFormula:C16H31NO2•HClColor and Shape:NeatMolecular weight:269.42 +(36.46)TMPH Hydrochloride
CAS:<p>TMPH Hydrochloride is a synthetic chemical compound commonly utilized in biochemical research. It is derived from synthetic processes involving organic chemistry techniques. The mode of action of TMPH Hydrochloride involves its interaction with neurotransmitter systems, where it functions by modulating receptor activity or inhibiting specific enzymatic pathways.</p>Formula:C16H31NO2·HClPurity:Min. 95%Molecular weight:269.42 g/molTMPH hydrochloride
CAS:<p>neuronal nicotinic ACh receptors (nAChRs) antagonist</p>Formula:C16H32ClNO2Purity:98%Color and Shape:SolidMolecular weight:305.88
