CAS 84954-93-8
:Rosarin
Description:
Rosarin, with the CAS number 84954-93-8, is a chemical compound that belongs to the class of natural products known as flavonoids. It is primarily derived from various plant sources and is noted for its potential antioxidant properties. Rosarin exhibits a characteristic structure that includes multiple hydroxyl groups, contributing to its reactivity and ability to scavenge free radicals. This compound is often studied for its biological activities, including anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. Additionally, Rosarin may play a role in plant pigmentation, contributing to the coloration of flowers and fruits. Its solubility can vary depending on the solvent used, and it is typically stable under standard conditions, although it may degrade when exposed to extreme pH levels or prolonged light. Overall, Rosarin represents a significant area of study within natural product chemistry, particularly for its health-related applications and potential benefits in food and pharmaceutical industries.
Formula:C20H28O10
InChI:InChI=1S/C20H28O10/c21-9-12-14(22)17(25)20(29-12)28-10-13-15(23)16(24)18(26)19(30-13)27-8-4-7-11-5-2-1-3-6-11/h1-7,12-26H,8-10H2/b7-4+/t12-,13+,14-,15+,16-,17+,18+,19+,20+/m0/s1
InChI key:InChIKey=IEBFEMIXXHIISM-YZOUKVLTSA-N
SMILES:C(O[C@@H]1O[C@@H](CO)[C@H](O)[C@H]1O)[C@H]2O[C@@H](OC/C=C/C3=CC=CC=C3)[C@H](O)[C@@H](O)[C@@H]2O
Synonyms:- (2E)-3-Phenyl-2-propen-1-yl 6-O-α-<span class="text-smallcaps">L</smallcap>-arabinofuranosyl-β-<smallcap>D</span>-glucopyranoside
- (2E)-3-Phenylprop-2-en-1-yl 6-O-alpha-L-arabinofuranosyl-beta-D-glucopyranoside
- Rosarin (glycoside)
- beta-D-glucopyranoside, (2E)-3-phenyl-2-propen-1-yl 6-O-alpha-L-arabinofuranosyl-
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (2E)-3-phenyl-2-propen-1-yl 6-O-α-<smallcap>L</span>-arabinofuranosyl-
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (2E)-3-phenyl-2-propenyl 6-O-α-<smallcap>L</span>-arabinofuranosyl-
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 3-phenyl-2-propenyl 6-O-α-<smallcap>L</span>-arabinofuranosyl-, (E)-
- β-D-Glucopyranoside, (2E)-3-phenyl-2-propen-1-yl 6-O-α-L-arabinofuranosyl-
- β-D-Glucopyranoside, 3-phenyl-2-propenyl 6-O-α-L-arabinofuranosyl-, (E)-
- Rosarin
- β-D-Glucopyranoside, (2E)-3-phenyl-2-propenyl 6-O-α-L-arabinofuranosyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
(2R,3R,4S,5S,6R)-2-(Cinnamyloxy)-6-((((2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)oxy)methyl)tetrahydro-2H-pyran-3,4,5-triol
CAS:Formula:C20H28O10Purity:98%Molecular weight:428.4303Rosarin
CAS:Rosarin is a natural product from Rhodiola rosea L.Formula:C20H28O10Purity:95%~99%Molecular weight:428.434Rosarin
CAS:Formula:C20H28O10Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:428.43Rosarin
CAS:Rosarin reduces inflammation and protects nerves by inhibiting iNOS, IL-1β, TNF-α in mouse kidneys and brain.Formula:C20H28O10Purity:99.14% - 99.95%Color and Shape:Brown Fine Powder With Characteristic OdorMolecular weight:428.43Rosarin
CAS:Natural glycosideFormula:C20H28O10Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:428.44Rosarin
CAS:Rosarin is a bioactive compound derived from the rhizomes of the Rhodiola rosea plant, which is known for its adaptogenic properties. This compound is classified as a phenolic glycoside and is extracted using solvent extraction and purification techniques to ensure high purity and efficacy.Formula:C20H28O10Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:428.43 g/mol









