CAS 849546-65-2

1,1-Dimethylethyl 4-(2-thiazolylamino)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(2-thiazolylamino)-1-piperidinecarboxylate, identified by its CAS number 849546-65-2, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound includes a thiazole moiety, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the dimethyl group indicates steric hindrance, which can influence the compound's reactivity and interaction with biological targets. The carboxylate functional group suggests that it may exhibit acidic properties, potentially affecting its solubility and stability in various environments. Additionally, the thiazole and piperidine components may impart specific pharmacological properties, making this compound of interest in drug development. Overall, the structural characteristics of this compound suggest it may have applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₃H₂₁N₃O₂S

InChI: InChI=1S/C13H21N3O2S/c1-13(2,3)18-12(17)16-7-4-10(5-8-16)15-11-14-6-9-19-11/h6,9-10H,4-5,7-8H2,1-3H3,(H,14,15)

InChI key: InChIKey=WIYJAVZGTOLQKS-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NC2=NC=CS2)CC1

Synonyms:

• 1,1-Dimethylethyl 4-(2-thiazolylamino)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-(2-thiazolylamino)-, 1,1-dimethylethyl ester

tert-Butyl 4-[(1,3-thiazol-2-yl)amino]piperidine-1-carboxylate

CAS: 849546-65-2

Versatile small molecule scaffold

Formula: C₁₃H₂₁N₃O₂S

Purity: Min. 95%

Molecular weight: 283.39 g/mol

Ref: 3D-ZIB54665