CAS 84955-31-7
:2-Amino-4-chloropyrrolo[2,3-d]pyrimidine
Description:
2-Amino-4-chloropyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of an amino group and a chlorine atom at specific positions on the ring structure enhances its reactivity and potential biological activity. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their anticancer and antiviral properties. The compound's CAS number, 84955-31-7, allows for easy identification in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as the presence of chlorine may pose specific hazards. Overall, 2-Amino-4-chloropyrrolo[2,3-d]pyrimidine represents a valuable compound for research in organic synthesis and drug discovery.
Formula:C6H5ClN4
InChI:InChI=1/C6H5ClN4/c7-4-3-1-2-9-5(3)11-6(8)10-4/h1-2H,(H3,8,9,10,11)
SMILES:c1cnc2c1c(Cl)[nH]c(=N)[nH]2
Synonyms:- 6-Chloro-7-deazaguanine
- 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine
- 2-Amino-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-chloropyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H5ClN4Purity:97%Color and Shape:SolidMolecular weight:168.58374-Chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine
CAS:Formula:C6H5ClN4Purity:97%Color and Shape:SolidMolecular weight:168.582-Amino-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
CAS:2-Amino-4-chloro-7H-pyrrolo[2,3-d]pyrimidineFormula:C6H5ClN4Purity:98%Color and Shape: yellow powderMolecular weight:168.58g/mol6-Chloro-7-deazaguanine
CAS:6-Chloro-7-deazaguanine (6CDG) is a pyrimidine nucleoside that is used in the treatment of hepatoblastoma and hepatitis. 6CDG is an alkylating agent that binds to DNA and causes strand breakage by forming covalent bonds with the N-7 position of guanine. It can also be used as an antiviral agent against herpes simplex virus, as it inhibits viral replication by inhibiting the viral DNA polymerase. 6CDG does not inhibit human DNA polymerase. The drug has been shown to be cytotoxic to MRC5 cells, which are resistant to pyrimidine analogs.
Formula:C6H5ClN4Purity:Min. 95%Color and Shape:PowderMolecular weight:168.58 g/mol6-Chloro-7-deazaguanine
CAS:Controlled ProductApplications 6-Chloro-7-deazaguanine (cas# 84955-31-7) is a compound useful in organic synthesis.
Formula:C6H5ClN4Color and Shape:NeatMolecular weight:168.58




