
CAS 84955-33-9
:4-Methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine
Description:
4-Methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its unique pyrrolo-pyrimidine structure. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the pyrrolo ring, which contributes to its chemical reactivity and potential biological activity. The presence of the amino group (-NH2) at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-cancer and anti-inflammatory activities. Its molecular structure allows for various synthetic modifications, making it a versatile scaffold for drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic rings. Overall, 4-Methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine represents a significant area of research in the field of organic and medicinal chemistry.
Formula:C8H10N4O
InChI:InChI=1S/C8H10N4O/c1-12-4-3-5-6(12)10-8(9)11-7(5)13-2/h3-4H,1-2H3,(H2,9,10,11)
InChI key:InChIKey=RCMVUDUMUQMIIH-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(N(C)C=C2)=NC(N)=N1
Synonyms:- 4-Methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine
- 7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 4-methoxy-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.