CymitQuimica logo

CAS 849550-05-6

:

Cevipabulin

Description:
Cevipabulin, identified by the CAS number 849550-05-6, is a synthetic compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is primarily investigated for its role as an anti-cancer agent. Cevipabulin functions by targeting specific cellular pathways, which may inhibit tumor growth and promote apoptosis in cancer cells. The compound exhibits a unique mechanism of action that differentiates it from traditional chemotherapeutic agents, potentially leading to reduced side effects and improved efficacy. Its pharmacological profile includes properties such as solubility and stability, which are crucial for its bioavailability and therapeutic effectiveness. Ongoing research aims to elucidate its full spectrum of biological activity, optimal dosing regimens, and potential combinations with other therapies. As with many investigational drugs, further clinical trials are necessary to establish its safety, efficacy, and overall role in cancer treatment protocols.
Formula:C18H18ClF5N6O
InChI:InChI=1S/C18H18ClF5N6O/c1-9(18(22,23)24)28-16-14(15(19)29-17-26-8-27-30(16)17)13-11(20)6-10(7-12(13)21)31-5-3-4-25-2/h6-9,25,28H,3-5H2,1-2H3/t9-/m0/s1
InChI key:ZUZPCOQWSYNWLU-VIFPVBQESA-N
SMILES:C[C@@H](C(F)(F)F)NC1=C(C(=NC2=NC=NN12)Cl)C3=C(C=C(C=C3F)OCCCNC)F
Synonyms:
  • 5-Chloro-6-[2,6-difluoro-4-[3-(methylamino)propoxy]phenyl]-N-((1S)-2,2,2-trifluoro-1-methylethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Found 4 products.