CAS 84956-71-8

2-(tert-Butyl)-4,5-dichloro-2,3-dihydropyridazin-3-one

Description:

2-(tert-Butyl)-4,5-dichloro-2,3-dihydropyridazin-3-one is a chemical compound characterized by its unique structure, which includes a pyridazine ring with two chlorine substituents and a tert-butyl group. This compound typically exhibits properties common to heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen atoms. The dichloro substituents can influence its chemical behavior, making it a candidate for various chemical reactions, including nucleophilic substitutions. The tert-butyl group contributes to steric hindrance, which can affect the compound's reactivity and interactions with other molecules. Additionally, the presence of the carbonyl group in the pyridazinone structure may impart acidic characteristics, allowing for potential applications in medicinal chemistry or as a building block in organic synthesis. Overall, this compound's unique structural features and functional groups make it of interest in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₁₀Cl₂N₂O

InChI: InChI=1S/C8H10Cl2N2O/c1-8(2,3)12-7(13)6(10)5(9)4-11-12/h4H,1-3H3

SMILES: CC(C)(C)n1c(=O)c(c(cn1)Cl)Cl

Synonyms:

• 4,5-Dichloro-2-(2-methyl-2-propanyl)-3(2H)-pyridazinone
• 3(2H)-Pyridazinone,4,5-dichloro-2-(1,1-dimethylethyl)-
• 2-tert-Butyl-4,5-Dichloro-3-2H-Pyridazinone

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one

CAS: 84956-71-8

Formula: C₈H₁₀Cl₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 221.0838

Ref: IN-DA008HNO

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one

CAS: 84956-71-8

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one

Purity: 97%

Molecular weight: 221.08g/mol

Ref: 54-OR27468

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one

CAS: 84956-71-8

Formula: C₈H₁₀Cl₂N₂O

Purity: 97%

Molecular weight: 221.08

Ref: 10-F240331

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one

CAS: 84956-71-8

2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one is a benzyl halogenated alkenyloxy inorganic base that reacts with hydrosulfide to form a halogenated product. It can be used as an alternative to phenol in organic synthesis. 2-(tert-Butyl)-4,5-dichloropyridazin-3(2H)-one is highly sensitive and should be handled with care. It is not recommended for use in the presence of air or moisture.

Formula: C₈H₁₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 221.1 g/mol

Ref: 3D-JDA95671