
CAS 84956-72-9
:5-Amino-4-chloro-2-(1,1-dimethylethyl)-3(2H)-pyridazinone
Description:
5-Amino-4-chloro-2-(1,1-dimethylethyl)-3(2H)-pyridazinone, with the CAS number 84956-72-9, is a chemical compound characterized by its pyridazinone structure, which includes a pyridazine ring with an amino group and a chloro substituent. This compound typically exhibits properties such as moderate solubility in polar solvents and may have varying stability depending on environmental conditions. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological systems. As an amino-substituted heterocyclic compound, it may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and characterization often involve standard organic chemistry techniques, including chromatography and spectroscopy for purity assessment. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and agrochemicals.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-8(2,3)12-7(13)6(9)5(10)4-11-12/h4H,10H2,1-3H3
InChI key:InChIKey=BZRMXBOTJIHNEZ-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C(=O)C(Cl)=C(N)C=N1
Synonyms:- 5-Amino-4-chloro-2-(1,1-dimethylethyl)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-amino-4-chloro-2-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.