CAS 84964-24-9

1-(3-bromophenyl)piperidine

Description:

1-(3-Bromophenyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromophenyl group at the 1-position of the piperidine ring introduces significant steric and electronic effects, influencing the compound's reactivity and interactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic characteristics. The bromine atom contributes to its potential as a building block in medicinal chemistry, particularly in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, making it of interest in research related to neuropharmacology and other fields. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₄BrN

InChI: InChI=1/C11H14BrN/c12-10-5-4-6-11(9-10)13-7-2-1-3-8-13/h4-6,9H,1-3,7-8H2

SMILES: C1CCN(CC1)c1cccc(c1)Br

Synonyms:

• N-(3-Bromophenyl)piperidine

1-(3-Bromophenyl)piperidine

CAS: 84964-24-9

Formula: C₁₁H₁₄BrN

Purity: 96%

Color and Shape: Liquid

Molecular weight: 240.1396

Ref: IN-DA008HJ5

1-(3-Bromophenyl)piperidine

CAS: 84964-24-9

1-(3-Bromophenyl)piperidine

Purity: 96%

Molecular weight: 240.14g/mol

Ref: 54-OR52751

1-(3-Bromophenyl)piperidine

CAS: 84964-24-9

Formula: C₁₁H₁₄BrN

Purity: 96%

Color and Shape: Liquid

Molecular weight: 240.144

Ref: 10-F211712