CAS 849662-80-2

[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]{4-[4-(1-methylethyl)piperazin-1-yl]phenyl}methanone

Description:

The chemical substance known as [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]{4-[4-(1-methylethyl)piperazin-1-yl]phenyl}methanone, with the CAS number 849662-80-2, is a complex organic compound characterized by its unique structural features, including a benzothiophene core and multiple functional groups. This compound exhibits properties typical of both phenolic and piperazine derivatives, which may contribute to its potential biological activity. The presence of hydroxyl groups suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the piperazine moiety may enhance its pharmacological profile, potentially affecting its interaction with biological targets. The compound's molecular structure indicates it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and stability, would require empirical determination through experimental methods. Overall, this compound represents a significant example of synthetic organic chemistry with potential applications in drug discovery and development.

Formula: C₂₈H₂₈N₂O₃S

InChI: InChI=1/C28H28N2O3S/c1-18(2)29-13-15-30(16-14-29)21-7-3-19(4-8-21)27(33)26-24-12-11-23(32)17-25(24)34-28(26)20-5-9-22(31)10-6-20/h3-12,17-18,31-32H,13-16H2,1-2H3

SMILES: CC(C)N1CCN(CC1)c1ccc(cc1)C(=O)c1c2ccc(cc2sc1c1ccc(cc1)O)O

[6-Hydroxy-2-(4-hydroxyphenyl)benzo[b]thien-3-yl][4-[4-(1-methylethyl)-1-piperazinyl]phenyl]methanone

CAS: 849662-80-2

Formula: C₂₈H₂₈N₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.5985

Ref: IN-DA008HJ0

Y134

CAS: 849662-80-2

Y134

Purity: ≥98%

Molecular weight: 472.6g/mol

Ref: 54-BUP03259

Y 134

Controlled Product

CAS: 849662-80-2

Formula: C₂₈H₂₈N₂O₃S

Color and Shape: Neat

Molecular weight: 472.599

Ref: TR-Y120005

Y134

CAS: 849662-80-2

Y134, an oral estrogen receptor inhibitor, is 121x more selective for ERα (Ki=0.09 nM) over ERβ (Ki=11.31 nM), and blocks ER+ breast cancer cell growth.

Formula: C₂₈H₂₈N₂O₃S

Purity: 99.98%

Color and Shape: Solid

Molecular weight: 472.6

Ref: TM-T23540