CAS 849675-66-7

N-[2-[2-[4-[2-(3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]phenyl]-2H-tetrazol-5-yl]-4,5-dimethoxyphenyl]-4-oxo-4H-1-benzopyran-2-carboxamide

Description:

N-[2-[2-[4-[2-(3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]phenyl]-2H-tetrazol-5-yl]-4,5-dimethoxyphenyl]-4-oxo-4H-1-benzopyran-2-carboxamide, with CAS number 849675-66-7, is a complex organic compound characterized by its multi-functional structure, which includes a benzopyran core, a carboxamide group, and various methoxy and tetrazole substituents. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties such as anti-inflammatory or anticancer effects. The presence of the isoquinoline moiety suggests possible interactions with biological targets, making it a candidate for further pharmacological studies. Its intricate structure indicates a high degree of molecular complexity, which can influence its solubility, stability, and reactivity. Additionally, the presence of multiple functional groups allows for diverse chemical interactions, potentially leading to various derivatives with tailored properties for specific applications in drug development. As with many synthetic compounds, understanding its characteristics requires thorough investigation through experimental studies and computational modeling.

Formula: C₃₈H₃₆N₆O₇

InChI: InChI=1S/C38H36N6O7/c1-47-32-17-24-14-16-43(22-25(24)18-33(32)48-2)15-13-23-9-11-26(12-10-23)44-41-37(40-42-44)28-19-34(49-3)35(50-4)20-29(28)39-38(46)36-21-30(45)27-7-5-6-8-31(27)51-36/h5-12,17-21H,13-16,22H2,1-4H3,(H,39,46)

InChI key: InChIKey=AHJUHHDDCJQACA-UHFFFAOYSA-N

SMILES: N(C(=O)C=1OC=2C(C(=O)C1)=CC=CC2)C3=C(C=C(OC)C(OC)=C3)C4=NN(N=N4)C5=CC=C(CCN6CC=7C(CC6)=CC(OC)=C(OC)C7)C=C5

Synonyms:

• N-[2-[2-[4-[2-(3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]phenyl]-2H-tetrazol-5-yl]-4,5-dimethoxyphenyl]-4-oxo-4H-1-benzopyran-2-carboxamide
• 4H-1-Benzopyran-2-carboxamide, N-[2-[2-[4-[2-(3,4-dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]phenyl]-2H-tetrazol-5-yl]-4,5-dimethoxyphenyl]-4-oxo-
• HM 30181
• Encequidar

HM 30181A

CAS: 849675-66-7

Formula: C₃₈H₃₆N₆O₇

Purity: %

Color and Shape: Solid

Molecular weight: 688.7284

Ref: IN-DA00G8C7

Encequidar

CAS: 849675-66-7

Encequidar

Purity: ≥98%

Molecular weight: 688.73g/mol

Ref: 54-BUP04781

Encequidar

CAS: 849675-66-7

Encequidar (HM30181A) is a potent and selective P-glycoprotein inhibitor.

Formula: C₃₈H₃₆N₆O₇

Purity: 99.93%

Color and Shape: Solid

Molecular weight: 688.73

Ref: TM-T8426

Encequidar

CAS: 849675-66-7

Encequidar is a small-molecule inhibitor, which is a synthetic chemical compound with the ability to modulate the activity of efflux transporters. It specifically targets P-glycoprotein (P-gp), an ATP-binding cassette transporter widely expressed in tissues such as the intestine, kidney, liver, and blood-brain barrier. By inhibiting P-gp, Encequidar enhances the oral bioavailability of co-administered therapeutic agents that are typically P-gp substrates, thereby improving their systemic absorption and therapeutic efficacy.

Formula: C₃₈H₃₆N₆O₇

Purity: Min. 95%

Molecular weight: 688.73 g/mol

Ref: 3D-ZIB67566