
CAS 849727-63-5
:4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-, hydrochloride (1:1)
Description:
4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-, hydrochloride (1:1), identified by CAS number 849727-63-5, is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a chloroethyl substituent, contributing to its potential reactivity and biological activity. The presence of a hydroxy group and a methyl group further influences its chemical properties, including solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for further understanding its behavior in different environments and potential therapeutic uses.
Formula:C11H15ClN2O2·ClH
InChI:InChI=1S/C11H15ClN2O2.ClH/c1-7-8(4-5-12)11(16)14-6-2-3-9(15)10(14)13-7;/h9,15H,2-6H2,1H3;1H
InChI key:InChIKey=YZWXZANAEMMNAW-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(C)=C1CCCl)C(O)CCC2.Cl
Synonyms:- 3-(2-Chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-, monohydrochloride
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
CAS:Formula:C11H16Cl2N2O2Molecular weight:279.1629
