CymitQuimica logo

CAS 84973-05-7

:

Quinoline,3-bromo-7-chloro-

Description:
Quinoline, 3-bromo-7-chloro- is a heterocyclic organic compound characterized by a fused bicyclic structure consisting of a benzene ring and a pyridine ring. The presence of bromine and chlorine substituents at the 3 and 7 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The bromine and chlorine atoms can influence the compound's electronic properties, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, quinoline derivatives are often studied for their biological activities, including antimicrobial and antitumor properties. Safety considerations should be taken into account when handling this compound, as halogenated compounds can pose environmental and health risks. Overall, 3-bromo-7-chloroquinoline represents a significant compound in the field of organic chemistry with diverse applications.
Formula:C9H5BrClN
InChI:InChI=1S/C9H5BrClN/c10-7-3-6-1-2-8(11)4-9(6)12-5-7/h1-5H
InChI key:AULIHGFJRSSSKE-UHFFFAOYSA-N
SMILES:C1=CC(=CC2=NC=C(C=C21)Br)Cl
Synonyms:
  • 3-Bromo-7-chloroquinoline
  • Quinoline, 3-bromo-7-chloro-
Found 4 products.