CAS 849751-74-2
:Glycine, N-(2-chloro-4-pyrimidinyl)-
Description:
Glycine, N-(2-chloro-4-pyrimidinyl)-, also known by its CAS number 849751-74-2, is a chemical compound that features a glycine moiety linked to a pyrimidine ring substituted with a chlorine atom. This compound typically exhibits characteristics common to both amino acids and heterocyclic compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and methanol due to the presence of the amino group. The chlorinated pyrimidine structure may impart specific biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. The presence of the glycine component suggests potential roles in biochemical processes, possibly as a building block in peptide synthesis or as a neurotransmitter modulator. Its stability and reactivity would depend on the specific conditions, including pH and temperature, and it may undergo various chemical reactions typical of both amino acids and halogenated compounds.
Formula:C6H6ClN3O2
InChI:InChI=1/C6H6ClN3O2/c7-6-8-2-1-4(10-6)9-3-5(11)12/h1-2H,3H2,(H,11,12)(H,8,9,10)
SMILES:c1cnc(Cl)[nH]c1=NCC(=O)O
Synonyms:- [(2-Chloro-4-pyrimidinyl)amino]acetic acid
- N-(2-Chloro-4-pyrimidinyl)glycine
- N-(2-Chloropyrimidin-4-yl)glycine
- N-(2-Chlorpyrimidin-4-yl)glycin
- glycine, N-(2-chloro-4-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.