CymitQuimica logo

CAS 849758-12-9

:

Methyl 4-bromo-3-fluorobenzoate

Description:
Methyl 4-bromo-3-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine and a fluorine atom, as well as a methoxycarbonyl group (the ester functional group). This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate polarity due to the presence of the ester group, which can influence its solubility in various organic solvents. Methyl 4-bromo-3-fluorobenzoate is often utilized in synthetic organic chemistry as an intermediate in the preparation of more complex molecules, particularly in pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electrophilic nature of the aromatic ring, making it suitable for further substitution reactions. Additionally, the presence of halogen substituents can enhance its biological activity and influence its interaction with biological systems. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H6BrFO2
InChI:InChI=1/C8H6BrFO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3
InChI key:WDAFDKXHLVMFKA-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(c(c1)F)Br
Synonyms:
  • Benzoic Acid, 4-Bromo-3-Fluoro-, Methyl Ester
Found 5 products.