CAS 849776-34-7

1,4'-bipiperidine-1'-carboximidamide hydroiodide

Description:

1,4'-Bipiperidine-1'-carboximidamide hydroiodide is a chemical compound characterized by its unique structure, which includes two piperidine rings connected by a carbon chain, along with a carboximidamide functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydroiodide salt, which enhances its solubility and stability. The presence of the carboximidamide group suggests potential biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and binding properties. As a hydroiodide salt, it may exhibit different physical and chemical properties compared to its free base form, such as altered melting points and solubility profiles. Safety and handling precautions should be observed, as with many chemical substances, particularly those that may have biological implications. Overall, 1,4'-bipiperidine-1'-carboximidamide hydroiodide represents a compound with potential applications in medicinal chemistry and related fields.

Formula: C₁₁H₂₃IN₄

InChI: InChI=1/C11H22N4.HI/c12-11(13)15-8-4-10(5-9-15)14-6-2-1-3-7-14;/h10H,1-9H2,(H3,12,13);1H

SMILES: C1CCN(CC1)C1CCN(CC1)C(=N)N.I

1,4'-Bipiperidine-1'-carboximidamide hydroiodide

CAS: 849776-34-7

1,4'-Bipiperidine-1'-carboximidamide hydroiodide

Formula: C₁₁H₂₂N₄·HI

Purity: 97%

Color and Shape: faint orange solid

Molecular weight: 338.23g/mol

Ref: 54-OR1477

1,4'-bipiperidine-1'-carboximidamide hydroiodide

CAS: 849776-34-7

Molecular weight: 338.23699951171875

Ref: 10-F518985