CAS 849776-37-0

4-cyclohexylpiperazine-1-carboximidamide hydroiodide

Description:

4-Cyclohexylpiperazine-1-carboximidamide hydroiodide is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a cyclohexyl group and a carboximidamide functional group. This compound is typically a white to off-white solid, and its hydroiodide salt form indicates the presence of iodide ions, which can influence its solubility and stability in various solvents. The presence of the piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored in medicinal chemistry for their pharmacological properties. The carboximidamide group may contribute to its reactivity and interactions with biological targets. In terms of safety and handling, as with many chemical substances, it is essential to follow appropriate safety protocols, including the use of personal protective equipment and proper storage conditions. Overall, 4-cyclohexylpiperazine-1-carboximidamide hydroiodide represents a compound of interest in both research and potential therapeutic applications.

Formula: C₁₁H₂₃IN₄

InChI: InChI=1/C11H22N4.HI/c12-11(13)15-8-6-14(7-9-15)10-4-2-1-3-5-10;/h10H,1-9H2,(H3,12,13);1H

SMILES: C1CCC(CC1)N1CCN(CC1)C(=N)N.I

4-Cyclohexylpiperazine-1-carboximidamide hydroiodide

CAS: 849776-37-0

4-Cyclohexylpiperazine-1-carboximidamide hydroiodide

Formula: C₁₁H₂₂N₄·HI

Purity: ≥95%

Color and Shape: colourless to white solid

Molecular weight: 338.23g/mol

Ref: 54-OR110027