CAS 849776-51-8

6,7-dimethoxy-3,4-dihydroisoquinoline-2(1H)-carboximidamide hydroiodide

Description:

6,7-Dimethoxy-3,4-dihydroisoquinoline-2(1H)-carboximidamide hydroiodide is a chemical compound characterized by its complex structure, which includes an isoquinoline core with methoxy substituents and a carboximidamide functional group. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydroiodide salt form. The presence of methoxy groups enhances its lipophilicity and may influence its biological activity. The carboximidamide moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through hydrogen bonding and other non-covalent interactions. The compound's unique structure may also confer specific pharmacological properties, making it of interest in research related to neurochemistry or other therapeutic areas. As with many chemical substances, safety data and handling precautions should be observed, particularly due to the presence of iodine in the hydroiodide form.

Formula: C₁₂H₁₈IN₃O₂

InChI: InChI=1/C12H17N3O2.HI/c1-16-10-5-8-3-4-15(12(13)14)7-9(8)6-11(10)17-2;/h5-6H,3-4,7H2,1-2H3,(H3,13,14);1H

SMILES: COc1cc2CCN(Cc2cc1OC)C(=N)N.I