CAS 84978-67-6

(3-furan-2-yl-1H-pyrazol-5-yl)methanol

Description:

(3-Furan-2-yl-1H-pyrazol-5-yl)methanol is a chemical compound characterized by its unique structure, which includes a furan ring and a pyrazole moiety. The presence of the furan ring contributes to its aromatic properties, while the pyrazole provides potential for various chemical reactivity due to its nitrogen-containing heterocycle. The methanol functional group indicates the presence of a hydroxyl (-OH) group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the electronic properties of the furan and pyrazole rings, as well as the hydroxymethyl group. Overall, (3-furan-2-yl-1H-pyrazol-5-yl)methanol is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its structural features and reactivity.

Formula: C₈H₈N₂O₂

InChI: InChI=1/C8H8N2O2/c11-5-6-4-7(10-9-6)8-2-1-3-12-8/h1-4,11H,5H2,(H,9,10)

SMILES: c1cc(c2cc(CO)[nH]n2)oc1

Synonyms:

• [5-(2-furyl)-1H-pyrazol-3-yl]methanol

[5-(2-Furyl)-1H-pyrazol-3-yl]methanol

CAS: 84978-67-6

Formula: C₈H₈N₂O₂

Color and Shape: Solid

Molecular weight: 164.1613

Ref: IN-DA004UHS

[5-(Fur-2-yl)-1H-pyrazol-3-yl]methanol

CAS: 84978-67-6

[5-(Fur-2-yl)-1H-pyrazol-3-yl]methanol

Formula: C₈H₈N₂O₂

Purity: 97%

Color and Shape: orange solid

Molecular weight: 164.16g/mol

Ref: 54-OR4420